C13H12N4O4S2 — CID 169359557
N-[4-(carbamothioylamino)phenyl]sulfonyl-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 169359557) has the molecular formula C13H12N4O4S2 and a molecular weight of 352.40 g/mol. Its IUPAC name is N-[4-(carbamothioylamino)phenyl]sulfonyl-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[4-(carbamothioylamino)phenyl]sulfonyl-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 169359557 |
| Molecular Formula | C13H12N4O4S2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | N-[4-(carbamothioylamino)phenyl]sulfonyl-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | NC(=S)Nc1ccc(S(=O)(=O)NC(=O)c2ccc[n+]([O-])c2)cc1 |
| InChI | InChI=1S/C13H12N4O4S2/c14-13(22)15-10-3-5-11(6-4-10)23(20,21)16-12(18)9-2-1-7-17(19)8-9/h1-8H,(H,16,18)(H3,14,15,22) |
| InChIKey | UVCPGIQVKLBWPM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|