C7H9N3O2 — CID 95931565
N'-methyl-1-oxidopyridin-1-ium-3-carbohydrazide (PubChem CID 95931565) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is N'-methyl-1-oxidopyridin-1-ium-3-carbohydrazide.
| Compound Name | N'-methyl-1-oxidopyridin-1-ium-3-carbohydrazide |
|---|---|
| PubChem CID | 95931565 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | N'-methyl-1-oxidopyridin-1-ium-3-carbohydrazide |
| SMILES | CNNC(=O)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C7H9N3O2/c1-8-9-7(11)6-3-2-4-10(12)5-6/h2-5,8H,1H3,(H,9,11) |
| InChIKey | XHURVXXGDPOZTQ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 68.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|