C22H16N4O4 — CID 177451297
1-oxido-3-[1,2,2-tris(1-oxidopyridin-1-ium-3-yl)ethenyl]pyridin-1-ium (PubChem CID 177451297) has the molecular formula C22H16N4O4 and a molecular weight of 400.39 g/mol. Its IUPAC name is 1-oxido-3-[1,2,2-tris(1-oxidopyridin-1-ium-3-yl)ethenyl]pyridin-1-ium.
| Compound Name | 1-oxido-3-[1,2,2-tris(1-oxidopyridin-1-ium-3-yl)ethenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 177451297 |
| Molecular Formula | C22H16N4O4 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-oxido-3-[1,2,2-tris(1-oxidopyridin-1-ium-3-yl)ethenyl]pyridin-1-ium |
| SMILES | [O-][n+]1cccc(C(=C(c2ccc[n+]([O-])c2)c2ccc[n+]([O-])c2)c2ccc[n+]([O-])c2)c1 |
| InChI | InChI=1S/C22H16N4O4/c27-23-9-1-5-17(13-23)21(18-6-2-10-24(28)14-18)22(19-7-3-11-25(29)15-19)20-8-4-12-26(30)16-20/h1-16H |
| InChIKey | BESGZPIUNPDVEY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 107.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|