C14H14N2O2 — CID 34643793
N-(2,3-dimethylphenyl)-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 34643793) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 34643793 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-(2,3-dimethylphenyl)-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2ccc[n+]([O-])c2)c1C |
| InChI | InChI=1S/C14H14N2O2/c1-10-5-3-7-13(11(10)2)15-14(17)12-6-4-8-16(18)9-12/h3-9H,1-2H3,(H,15,17) |
| InChIKey | PKFFNFTXWLWQRC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|