C13H10N4O9 — CID 44887150
1-(1-oxidopyridin-1-ium-3-yl)ethanone;2,4,6-trinitrophenol (PubChem CID 44887150) has the molecular formula C13H10N4O9 and a molecular weight of 366.24 g/mol. Its IUPAC name is 1-(1-oxidopyridin-1-ium-3-yl)ethanone;2,4,6-trinitrophenol.
| Compound Name | 1-(1-oxidopyridin-1-ium-3-yl)ethanone;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 44887150 |
| Molecular Formula | C13H10N4O9 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 1-(1-oxidopyridin-1-ium-3-yl)ethanone;2,4,6-trinitrophenol |
| SMILES | CC(=O)c1ccc[n+]([O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H7NO2.C6H3N3O7/c1-6(9)7-3-2-4-8(10)5-7;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h2-5H,1H3;1-2,10H |
| InChIKey | ISEJMHKMNVXNKH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 193.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|