C16H11N5O9 — CID 44889563
1-(1-oxidopyridin-1-ium-4-yl)pyridin-1-ium-3-olate;2,4,6-trinitrophenol (PubChem CID 44889563) has the molecular formula C16H11N5O9 and a molecular weight of 417.29 g/mol. Its IUPAC name is 1-(1-oxidopyridin-1-ium-4-yl)pyridin-1-ium-3-olate;2,4,6-trinitrophenol.
| Compound Name | 1-(1-oxidopyridin-1-ium-4-yl)pyridin-1-ium-3-olate;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 44889563 |
| Molecular Formula | C16H11N5O9 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 1-(1-oxidopyridin-1-ium-4-yl)pyridin-1-ium-3-olate;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.[O-]c1ccc[n+](-c2cc[n+]([O-])cc2)c1 |
| InChI | InChI=1S/C10H8N2O2.C6H3N3O7/c13-10-2-1-5-11(8-10)9-3-6-12(14)7-4-9;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-8H;1-2,10H |
| InChIKey | DYLLWAQXYLRYTD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 203.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|