C12H6MnN6O14 — CID 131879151
manganese;bis(2,4,6-trinitrophenol) (PubChem CID 131879151) has the molecular formula C12H6MnN6O14 and a molecular weight of 513.15 g/mol. Its IUPAC name is manganese;bis(2,4,6-trinitrophenol).
| Compound Name | manganese;bis(2,4,6-trinitrophenol) |
|---|---|
| PubChem CID | 131879151 |
| Molecular Formula | C12H6MnN6O14 |
| Molecular Weight | 513.15 g/mol |
| Exact Mass | 512.93 |
| IUPAC Name | manganese;bis(2,4,6-trinitrophenol) |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.[Mn] |
| InChI | InChI=1S/2C6H3N3O7.Mn/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h2*1-2,10H; |
| InChIKey | WKUOHEYIPUVJAM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 299.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|