C7H4N2O7 — CID 11873
2-hydroxy-3,5-dinitrobenzoic acid (PubChem CID 11873) has the molecular formula C7H4N2O7 and a molecular weight of 228.12 g/mol. Its IUPAC name is 2-hydroxy-3,5-dinitrobenzoic acid.
| Compound Name | 2-hydroxy-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 11873 |
| Molecular Formula | C7H4N2O7 |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 2-hydroxy-3,5-dinitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C7H4N2O7/c10-6-4(7(11)12)1-3(8(13)14)2-5(6)9(15)16/h1-2,10H,(H,11,12) |
| InChIKey | LWFUFLREGJMOIZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|