C20H14N4O11S — CID 87931041
1-(2,4-dinitrophenyl)sulfonyl-2,4-dinitrobenzene;1-phenylethanone (PubChem CID 87931041) has the molecular formula C20H14N4O11S and a molecular weight of 518.42 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)sulfonyl-2,4-dinitrobenzene;1-phenylethanone.
| Compound Name | 1-(2,4-dinitrophenyl)sulfonyl-2,4-dinitrobenzene;1-phenylethanone |
|---|---|
| PubChem CID | 87931041 |
| Molecular Formula | C20H14N4O11S |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 1-(2,4-dinitrophenyl)sulfonyl-2,4-dinitrobenzene;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=[N+]([O-])c1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H6N4O10S.C8H8O/c17-13(18)7-1-3-11(9(5-7)15(21)22)27(25,26)12-4-2-8(14(19)20)6-10(12)16(23)24;1-7(9)8-5-3-2-4-6-8/h1-6H;2-6H,1H3 |
| InChIKey | RGKZPSONGHOMGI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 223.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|