About nitromethane;1-phenylethanone
nitromethane;1-phenylethanone (PubChem CID 91277497) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is nitromethane;1-phenylethanone.
Molecular Properties
| Compound Name | nitromethane;1-phenylethanone |
| PubChem CID | 91277497 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | nitromethane;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.C[N+](=O)[O-] |
| InChI | InChI=1S/C8H8O.CH3NO2/c1-7(9)8-5-3-2-4-6-8;1-2(3)4/h2-6H,1H3;1H3 |
| InChIKey | KSKHMZZHCXOFRN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitromethane;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitromethane;1-phenylethanone?
The IUPAC name of nitromethane;1-phenylethanone (CID 91277497) is nitromethane;1-phenylethanone.
What is the SMILES notation for nitromethane;1-phenylethanone?
The canonical SMILES for nitromethane;1-phenylethanone is CC(=O)c1ccccc1.C[N+](=O)[O-].
What is the InChIKey of nitromethane;1-phenylethanone?
The InChIKey is KSKHMZZHCXOFRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.CH3NO2/c1-7(9)8-5-3-2-4-6-8;1-2(3)4/h2-6H,1H3;1H3.
What are the key properties of nitromethane;1-phenylethanone?
nitromethane;1-phenylethanone has a molecular weight of 181.19 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitromethane;1-phenylethanone is sourced from PubChem (CID 91277497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).