C12H7N3O8S — CID 611987
2,4-dinitro-1-(4-nitrophenyl)sulfonylbenzene (PubChem CID 611987) has the molecular formula C12H7N3O8S and a molecular weight of 353.27 g/mol. Its IUPAC name is 2,4-dinitro-1-(4-nitrophenyl)sulfonylbenzene.
| Compound Name | 2,4-dinitro-1-(4-nitrophenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 611987 |
| Molecular Formula | C12H7N3O8S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 2,4-dinitro-1-(4-nitrophenyl)sulfonylbenzene |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H7N3O8S/c16-13(17)8-1-4-10(5-2-8)24(22,23)12-6-3-9(14(18)19)7-11(12)15(20)21/h1-7H |
| InChIKey | NDYLISSAVOGESH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 163.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|