C6H6N4O6S — CID 12561635
2,4-dinitrobenzenesulfonohydrazide (PubChem CID 12561635) has the molecular formula C6H6N4O6S and a molecular weight of 262.20 g/mol. Its IUPAC name is 2,4-dinitrobenzenesulfonohydrazide.
| Compound Name | 2,4-dinitrobenzenesulfonohydrazide |
|---|---|
| PubChem CID | 12561635 |
| Molecular Formula | C6H6N4O6S |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2,4-dinitrobenzenesulfonohydrazide |
| SMILES | NNS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N4O6S/c7-8-17(15,16)6-2-1-4(9(11)12)3-5(6)10(13)14/h1-3,8H,7H2 |
| InChIKey | OEIFSMDIUWGNCS-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|