C8H7ClN2O7S — CID 4139852
2-chloroethyl 2,4-dinitrobenzenesulfonate (PubChem CID 4139852) has the molecular formula C8H7ClN2O7S and a molecular weight of 310.67 g/mol. Its IUPAC name is 2-chloroethyl 2,4-dinitrobenzenesulfonate.
| Compound Name | 2-chloroethyl 2,4-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 4139852 |
| Molecular Formula | C8H7ClN2O7S |
| Molecular Weight | 310.67 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 2-chloroethyl 2,4-dinitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)OCCCl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7ClN2O7S/c9-3-4-18-19(16,17)8-2-1-6(10(12)13)5-7(8)11(14)15/h1-2,5H,3-4H2 |
| InChIKey | ITMCKRNFXSQMNV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.67 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|