C12H15N3O9S — CID 125498880
[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,4-dinitrobenzenesulfonate (PubChem CID 125498880) has the molecular formula C12H15N3O9S and a molecular weight of 377.33 g/mol. Its IUPAC name is [methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,4-dinitrobenzenesulfonate.
| Compound Name | [methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,4-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 125498880 |
| Molecular Formula | C12H15N3O9S |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | [methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,4-dinitrobenzenesulfonate |
| SMILES | CN(OS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H15N3O9S/c1-12(2,3)23-11(16)13(4)24-25(21,22)10-6-5-8(14(17)18)7-9(10)15(19)20/h5-7H,1-4H3 |
| InChIKey | IFNPKEMKBXHNNR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|