C14H18N4O8S — CID 54374020
tert-butyl (3S)-3-[(2,4-dinitrophenyl)sulfonylamino]-4-oxobutanimidate (PubChem CID 54374020) has the molecular formula C14H18N4O8S and a molecular weight of 402.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2,4-dinitrophenyl)sulfonylamino]-4-oxobutanimidate.
| Compound Name | tert-butyl (3S)-3-[(2,4-dinitrophenyl)sulfonylamino]-4-oxobutanimidate |
|---|---|
| PubChem CID | 54374020 |
| Molecular Formula | C14H18N4O8S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | tert-butyl (3S)-3-[(2,4-dinitrophenyl)sulfonylamino]-4-oxobutanimidate |
| SMILES | [H]/N=C(/C[C@@H](C=O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])OC(C)(C)C |
| InChI | InChI=1S/C14H18N4O8S/c1-14(2,3)26-13(15)6-9(8-19)16-27(24,25)12-5-4-10(17(20)21)7-11(12)18(22)23/h4-5,7-9,15-16H,6H2,1-3H3/b15-13-/t9-/m0/s1 |
| InChIKey | LEPNVUCWJZTTBV-BFBVWJMCSA-N |
| XLogP | 1.53 |
| TPSA | 182.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|