C15H24N2O6SSi — CID 132575113
N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropan-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 132575113) has the molecular formula C15H24N2O6SSi and a molecular weight of 388.52 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropan-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropan-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 132575113 |
| Molecular Formula | C15H24N2O6SSi |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropan-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](C=O)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H24N2O6SSi/c1-15(2,3)25(4,5)23-11-12(10-18)16-24(21,22)14-9-7-6-8-13(14)17(19)20/h6-10,12,16H,11H2,1-5H3/t12-/m1/s1 |
| InChIKey | ULWQKTCMOGCBLP-GFCCVEGCSA-N |
| XLogP | 2.46 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|