C24H41N3O9SSi — CID 25112538
ethyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-nitrophenyl)sulfonylamino]pentanoate (PubChem CID 25112538) has the molecular formula C24H41N3O9SSi and a molecular weight of 575.76 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-nitrophenyl)sulfonylamino]pentanoate.
| Compound Name | ethyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-nitrophenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 25112538 |
| Molecular Formula | C24H41N3O9SSi |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | ethyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-nitrophenyl)sulfonylamino]pentanoate |
| SMILES | CCOC(=O)[C@@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])[C@H](CCNC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41N3O9SSi/c1-10-34-21(28)20(26-37(32,33)19-14-12-11-13-17(19)27(30)31)18(36-38(8,9)24(5,6)7)15-16-25-22(29)35-23(2,3)4/h11-14,18,20,26H,10,15-16H2,1-9H3,(H,25,29)/t18-,20-/m0/s1 |
| InChIKey | ROJWRHIDPHFGCZ-ICSRJNTNSA-N |
| XLogP | 4.11 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|