C20H34N4O6S — CID 11282551
tert-butyl N-[7-[2-[(2-nitrophenyl)sulfonylamino]ethylamino]heptyl]carbamate (PubChem CID 11282551) has the molecular formula C20H34N4O6S and a molecular weight of 458.58 g/mol. Its IUPAC name is tert-butyl N-[7-[2-[(2-nitrophenyl)sulfonylamino]ethylamino]heptyl]carbamate.
| Compound Name | tert-butyl N-[7-[2-[(2-nitrophenyl)sulfonylamino]ethylamino]heptyl]carbamate |
|---|---|
| PubChem CID | 11282551 |
| Molecular Formula | C20H34N4O6S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | tert-butyl N-[7-[2-[(2-nitrophenyl)sulfonylamino]ethylamino]heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCNCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H34N4O6S/c1-20(2,3)30-19(25)22-14-10-6-4-5-9-13-21-15-16-23-31(28,29)18-12-8-7-11-17(18)24(26)27/h7-8,11-12,21,23H,4-6,9-10,13-16H2,1-3H3,(H,22,25) |
| InChIKey | YNHVIWGPSLBWHF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|