C19H29N3O8S — CID 59537074
methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-(2-nitrophenyl)sulfonylamino]propanoate (PubChem CID 59537074) has the molecular formula C19H29N3O8S and a molecular weight of 459.52 g/mol. Its IUPAC name is methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-(2-nitrophenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-(2-nitrophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 59537074 |
| Molecular Formula | C19H29N3O8S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-(2-nitrophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(C)N(CCCCNC(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H29N3O8S/c1-14(17(23)29-5)21(13-9-8-12-20-18(24)30-19(2,3)4)31(27,28)16-11-7-6-10-15(16)22(25)26/h6-7,10-11,14H,8-9,12-13H2,1-5H3,(H,20,24) |
| InChIKey | QLVNVZXKNVBXFO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|