C16H24N4O4S — CID 22727484
tert-butyl N-[4-[(2-nitrophenyl)carbamothioylamino]butyl]carbamate (PubChem CID 22727484) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-nitrophenyl)carbamothioylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-nitrophenyl)carbamothioylamino]butyl]carbamate |
|---|---|
| PubChem CID | 22727484 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | tert-butyl N-[4-[(2-nitrophenyl)carbamothioylamino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNC(=S)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N4O4S/c1-16(2,3)24-15(21)18-11-7-6-10-17-14(25)19-12-8-4-5-9-13(12)20(22)23/h4-5,8-9H,6-7,10-11H2,1-3H3,(H,18,21)(H2,17,19,25) |
| InChIKey | DKSCIWGXLLNZTG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|