C22H36N6O4S — CID 87388953
tert-butyl N-[3-[4-[3-[(2-nitrophenyl)carbamothioylamino]propyl]piperazin-1-yl]propyl]carbamate (PubChem CID 87388953) has the molecular formula C22H36N6O4S and a molecular weight of 480.64 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[3-[(2-nitrophenyl)carbamothioylamino]propyl]piperazin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[3-[(2-nitrophenyl)carbamothioylamino]propyl]piperazin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 87388953 |
| Molecular Formula | C22H36N6O4S |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | tert-butyl N-[3-[4-[3-[(2-nitrophenyl)carbamothioylamino]propyl]piperazin-1-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN1CCN(CCCNC(=S)Nc2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H36N6O4S/c1-22(2,3)32-21(29)24-11-7-13-27-16-14-26(15-17-27)12-6-10-23-20(33)25-18-8-4-5-9-19(18)28(30)31/h4-5,8-9H,6-7,10-17H2,1-3H3,(H,24,29)(H2,23,25,33) |
| InChIKey | YFMJYUKZFWXPFP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|