C34H45N7O10S2 — CID 10676684
tert-butyl N-[5-[3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-trien-6-yl]pentyl]carbamate (PubChem CID 10676684) has the molecular formula C34H45N7O10S2 and a molecular weight of 775.91 g/mol. Its IUPAC name is tert-butyl N-[5-[3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-trien-6-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-trien-6-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 10676684 |
| Molecular Formula | C34H45N7O10S2 |
| Molecular Weight | 775.91 g/mol |
| Exact Mass | 775.27 |
| IUPAC Name | tert-butyl N-[5-[3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-trien-6-yl]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCN1CCCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])Cc2cccc(n2)CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C34H45N7O10S2/c1-34(2,3)51-33(42)35-19-9-4-10-20-37-21-12-22-38(52(47,48)31-17-7-5-15-29(31)40(43)44)25-27-13-11-14-28(36-27)26-39(24-23-37)53(49,50)32-18-8-6-16-30(32)41(45)46/h5-8,11,13-18H,4,9-10,12,19-26H2,1-3H3,(H,35,42) |
| InChIKey | SVEWKLZIRPDYMQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 215.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|