C15H30N4O3S — CID 84550530
tert-butyl N-[2-(3-morpholin-4-ylpropylcarbamothioylamino)ethyl]carbamate (PubChem CID 84550530) has the molecular formula C15H30N4O3S and a molecular weight of 346.50 g/mol. Its IUPAC name is tert-butyl N-[2-(3-morpholin-4-ylpropylcarbamothioylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-morpholin-4-ylpropylcarbamothioylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 84550530 |
| Molecular Formula | C15H30N4O3S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | tert-butyl N-[2-(3-morpholin-4-ylpropylcarbamothioylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=S)NCCCN1CCOCC1 |
| InChI | InChI=1S/C15H30N4O3S/c1-15(2,3)22-14(20)18-7-6-17-13(23)16-5-4-8-19-9-11-21-12-10-19/h4-12H2,1-3H3,(H,18,20)(H2,16,17,23) |
| InChIKey | YCZDUKDINDRUPR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|