C19H40IN5O3 — CID 111757914
tert-butyl N-[3-[[[amino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]pentan-3-yl]carbamate;hydroiodide (PubChem CID 111757914) has the molecular formula C19H40IN5O3 and a molecular weight of 513.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[[amino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]pentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[[amino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]pentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111757914 |
| Molecular Formula | C19H40IN5O3 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | tert-butyl N-[3-[[[amino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]pentan-3-yl]carbamate;hydroiodide |
| SMILES | CCC(CC)(C/N=C(\N)NCCCN1CCOCC1)NC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H39N5O3.HI/c1-6-19(7-2,23-17(25)27-18(3,4)5)15-22-16(20)21-9-8-10-24-11-13-26-14-12-24;/h6-15H2,1-5H3,(H,23,25)(H3,20,21,22);1H |
| InChIKey | JMUITBTYXZHWJZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|