C17H36IN5O3 — CID 110026996
tert-butyl N-[4-[[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]butyl]carbamate;hydroiodide (PubChem CID 110026996) has the molecular formula C17H36IN5O3 and a molecular weight of 485.41 g/mol. Its IUPAC name is tert-butyl N-[4-[[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]butyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[4-[[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]butyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110026996 |
| Molecular Formula | C17H36IN5O3 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | tert-butyl N-[4-[[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]butyl]carbamate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)NCCCCN/C(N)=N/CCCN1CCOCC1.I |
| InChI | InChI=1S/C17H35N5O3.HI/c1-17(2,3)25-16(23)21-8-5-4-7-19-15(18)20-9-6-10-22-11-13-24-14-12-22;/h4-14H2,1-3H3,(H,21,23)(H3,18,19,20);1H |
| InChIKey | YHSMYBXXUUVRHM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|