C24H48N4O4 — CID 68676140
tert-butyl N-[5-[4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]piperazin-1-yl]pentyl]carbamate (PubChem CID 68676140) has the molecular formula C24H48N4O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is tert-butyl N-[5-[4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]piperazin-1-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]piperazin-1-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 68676140 |
| Molecular Formula | C24H48N4O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.37 |
| IUPAC Name | tert-butyl N-[5-[4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]piperazin-1-yl]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCN1CCN(CCCCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H48N4O4/c1-23(2,3)31-21(29)25-13-9-7-11-15-27-17-19-28(20-18-27)16-12-8-10-14-26-22(30)32-24(4,5)6/h7-20H2,1-6H3,(H,25,29)(H,26,30) |
| InChIKey | UUMPHOVIAGGDEB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|