C27H51N3O8 — CID 176953652
tert-butyl N-[3-[4-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]piperazin-1-yl]propyl]carbamate (PubChem CID 176953652) has the molecular formula C27H51N3O8 and a molecular weight of 545.72 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]piperazin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]piperazin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 176953652 |
| Molecular Formula | C27H51N3O8 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.37 |
| IUPAC Name | tert-butyl N-[3-[4-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]piperazin-1-yl]propyl]carbamate |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCN1CCN(CCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H51N3O8/c1-5-14-32-16-18-34-20-22-36-24-25-37-23-21-35-19-17-33-15-13-30-11-9-29(10-12-30)8-6-7-28-26(31)38-27(2,3)4/h1H,6-25H2,2-4H3,(H,28,31) |
| InChIKey | PVZQAZNOTBIEAG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|