C18H37N3O4 — CID 158666414
tert-butyl N-[2-[2-[4-(2-propoxyethyl)piperazin-1-yl]ethoxy]ethyl]carbamate (PubChem CID 158666414) has the molecular formula C18H37N3O4 and a molecular weight of 359.51 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-(2-propoxyethyl)piperazin-1-yl]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[4-(2-propoxyethyl)piperazin-1-yl]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 158666414 |
| Molecular Formula | C18H37N3O4 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | tert-butyl N-[2-[2-[4-(2-propoxyethyl)piperazin-1-yl]ethoxy]ethyl]carbamate |
| SMILES | CCCOCCN1CCN(CCOCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H37N3O4/c1-5-13-23-15-11-20-7-9-21(10-8-20)12-16-24-14-6-19-17(22)25-18(2,3)4/h5-16H2,1-4H3,(H,19,22) |
| InChIKey | JDBTUURUKGSWOO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|