C14H28N2O3 — CID 174949673
[4-(2-propoxyethyl)piperazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174949673) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is [4-(2-propoxyethyl)piperazin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(2-propoxyethyl)piperazin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174949673 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | [4-(2-propoxyethyl)piperazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CCCOCCN1CCN(OC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H28N2O3/c1-5-11-18-12-10-15-6-8-16(9-7-15)19-13(17)14(2,3)4/h5-12H2,1-4H3 |
| InChIKey | IRPRIXLTGYEJQD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|