C12H23BrN2O2 — CID 174567323
[4-(3-bromopropyl)piperazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174567323) has the molecular formula C12H23BrN2O2 and a molecular weight of 307.23 g/mol. Its IUPAC name is [4-(3-bromopropyl)piperazin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(3-bromopropyl)piperazin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174567323 |
| Molecular Formula | C12H23BrN2O2 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [4-(3-bromopropyl)piperazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCN(CCCBr)CC1 |
| InChI | InChI=1S/C12H23BrN2O2/c1-12(2,3)11(16)17-15-9-7-14(8-10-15)6-4-5-13/h4-10H2,1-3H3 |
| InChIKey | MZRWTNRVXTUZEV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|