C11H20INO2 — CID 174751295
[4-(iodomethyl)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174751295) has the molecular formula C11H20INO2 and a molecular weight of 325.19 g/mol. Its IUPAC name is [4-(iodomethyl)piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(iodomethyl)piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174751295 |
| Molecular Formula | C11H20INO2 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | [4-(iodomethyl)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(CI)CC1 |
| InChI | InChI=1S/C11H20INO2/c1-11(2,3)10(14)15-13-6-4-9(8-12)5-7-13/h9H,4-8H2,1-3H3 |
| InChIKey | FDXSPIAOXPUJDI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|