About [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate
[(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174835809) has the molecular formula C10H18FNO2
and a molecular weight of 203.26 g/mol. Its IUPAC name is [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate.
Analyze [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate?
The IUPAC name of [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate (CID 174835809) is [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)ON1CC[C@@H](CF)C1.
What is the InChIKey of [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate?
The InChIKey is CMBXVLDYKDLLPN-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H18FNO2/c1-10(2,3)9(13)14-12-5-4-8(6-11)7-12/h8H,4-7H2,1-3H3/t8-/m0/s1.
What are the key properties of [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate?
[(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate has a molecular weight of 203.26 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-(fluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 174835809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).