C10H19NO2S — CID 175267538
[(3S)-3-sulfanylpiperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 175267538) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is [(3S)-3-sulfanylpiperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S)-3-sulfanylpiperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175267538 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | [(3S)-3-sulfanylpiperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC[C@H](S)C1 |
| InChI | InChI=1S/C10H19NO2S/c1-10(2,3)9(12)13-11-6-4-5-8(14)7-11/h8,14H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | ZPUUZDXJKCNBCF-QMMMGPOBSA-N |
| XLogP | 1.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|