C11H19NO3 — CID 174553162
(4-formylpiperidin-1-yl) 2,2-dimethylpropanoate (PubChem CID 174553162) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (4-formylpiperidin-1-yl) 2,2-dimethylpropanoate.
| Compound Name | (4-formylpiperidin-1-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174553162 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (4-formylpiperidin-1-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(C=O)CC1 |
| InChI | InChI=1S/C11H19NO3/c1-11(2,3)10(14)15-12-6-4-9(8-13)5-7-12/h8-9H,4-7H2,1-3H3 |
| InChIKey | ICTISXXRSXVPNB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|