C10H18N4O2 — CID 150222079
(4-azidopiperidin-1-yl) 2,2-dimethylpropanoate (PubChem CID 150222079) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is (4-azidopiperidin-1-yl) 2,2-dimethylpropanoate.
| Compound Name | (4-azidopiperidin-1-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 150222079 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (4-azidopiperidin-1-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(N=[N+]=[N-])CC1 |
| InChI | InChI=1S/C10H18N4O2/c1-10(2,3)9(15)16-14-6-4-8(5-7-14)12-13-11/h8H,4-7H2,1-3H3 |
| InChIKey | FTRVAQUMTQUHKL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|