C9H17NO2S — CID 174754591
[(3S)-3-sulfanylpyrrolidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174754591) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is [(3S)-3-sulfanylpyrrolidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S)-3-sulfanylpyrrolidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174754591 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | [(3S)-3-sulfanylpyrrolidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CC[C@H](S)C1 |
| InChI | InChI=1S/C9H17NO2S/c1-9(2,3)8(11)12-10-5-4-7(13)6-10/h7,13H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | VZGSUAVPFZFMGH-ZETCQYMHSA-N |
| XLogP | 1.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|