C11H21N3O3 — CID 174503474
[4-[amino(formyl)amino]piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174503474) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is [4-[amino(formyl)amino]piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[amino(formyl)amino]piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174503474 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | [4-[amino(formyl)amino]piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(N(N)C=O)CC1 |
| InChI | InChI=1S/C11H21N3O3/c1-11(2,3)10(16)17-13-6-4-9(5-7-13)14(12)8-15/h8-9H,4-7,12H2,1-3H3 |
| InChIKey | KKROJWWCKLOQKT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|