About tert-butyl 4-formylpiperidine-1-carboxylate;methanol
tert-butyl 4-formylpiperidine-1-carboxylate;methanol (PubChem CID 162380340) has the molecular formula C12H23NO4
and a molecular weight of 245.32 g/mol. Its IUPAC name is tert-butyl 4-formylpiperidine-1-carboxylate;methanol.
Molecular Properties
| Compound Name | tert-butyl 4-formylpiperidine-1-carboxylate;methanol |
| PubChem CID | 162380340 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | tert-butyl 4-formylpiperidine-1-carboxylate;methanol |
| SMILES | CC(C)(C)OC(=O)N1CCC(C=O)CC1.CO |
| InChI | InChI=1S/C11H19NO3.CH4O/c1-11(2,3)15-10(14)12-6-4-9(8-13)5-7-12;1-2/h8-9H,4-7H2,1-3H3;2H,1H3 |
| InChIKey | WPMIKSGLQRFRMD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-formylpiperidine-1-carboxylate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-formylpiperidine-1-carboxylate;methanol?
The IUPAC name of tert-butyl 4-formylpiperidine-1-carboxylate;methanol (CID 162380340) is tert-butyl 4-formylpiperidine-1-carboxylate;methanol.
What is the SMILES notation for tert-butyl 4-formylpiperidine-1-carboxylate;methanol?
The canonical SMILES for tert-butyl 4-formylpiperidine-1-carboxylate;methanol is CC(C)(C)OC(=O)N1CCC(C=O)CC1.CO.
What is the InChIKey of tert-butyl 4-formylpiperidine-1-carboxylate;methanol?
The InChIKey is WPMIKSGLQRFRMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3.CH4O/c1-11(2,3)15-10(14)12-6-4-9(8-13)5-7-12;1-2/h8-9H,4-7H2,1-3H3;2H,1H3.
What are the key properties of tert-butyl 4-formylpiperidine-1-carboxylate;methanol?
tert-butyl 4-formylpiperidine-1-carboxylate;methanol has a molecular weight of 245.32 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-formylpiperidine-1-carboxylate;methanol is sourced from PubChem (CID 162380340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).