C14H23NO2 — CID 134982303
tert-butyl 4-[(1Z)-buta-1,3-dienyl]piperidine-1-carboxylate (PubChem CID 134982303) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is tert-butyl 4-[(1Z)-buta-1,3-dienyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1Z)-buta-1,3-dienyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134982303 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | tert-butyl 4-[(1Z)-buta-1,3-dienyl]piperidine-1-carboxylate |
| SMILES | C=C/C=C\C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H23NO2/c1-5-6-7-12-8-10-15(11-9-12)13(16)17-14(2,3)4/h5-7,12H,1,8-11H2,2-4H3/b7-6- |
| InChIKey | OSRVYHUYPPXFSE-SREVYHEPSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|