C17H24N2O2 — CID 67067068
tert-butyl 4-(2-pyridin-4-ylethenyl)piperidine-1-carboxylate (PubChem CID 67067068) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is tert-butyl 4-(2-pyridin-4-ylethenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-pyridin-4-ylethenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67067068 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | tert-butyl 4-(2-pyridin-4-ylethenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C=Cc2ccncc2)CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-17(2,3)21-16(20)19-12-8-15(9-13-19)5-4-14-6-10-18-11-7-14/h4-7,10-11,15H,8-9,12-13H2,1-3H3 |
| InChIKey | DMDGNYXNTRMLOE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |