C17H24N2O3 — CID 67217796
tert-butyl 4-hydroxy-4-(2-pyridin-4-ylethenyl)piperidine-1-carboxylate (PubChem CID 67217796) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-(2-pyridin-4-ylethenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-(2-pyridin-4-ylethenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67217796 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl 4-hydroxy-4-(2-pyridin-4-ylethenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(C=Cc2ccncc2)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-16(2,3)22-15(20)19-12-8-17(21,9-13-19)7-4-14-5-10-18-11-6-14/h4-7,10-11,21H,8-9,12-13H2,1-3H3 |
| InChIKey | CBVZWPNZXWTXTL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |