C18H26N2O4 — CID 58993693
1-O-tert-butyl 4-O-ethyl 4-pyridin-4-ylpiperidine-1,4-dicarboxylate (PubChem CID 58993693) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 4-pyridin-4-ylpiperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl 4-pyridin-4-ylpiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58993693 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 4-pyridin-4-ylpiperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1(c2ccncc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H26N2O4/c1-5-23-15(21)18(14-6-10-19-11-7-14)8-12-20(13-9-18)16(22)24-17(2,3)4/h6-7,10-11H,5,8-9,12-13H2,1-4H3 |
| InChIKey | SWCFLUIFMCJXPG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |