C14H22NO6- — CID 132989321
4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylate (PubChem CID 132989321) has the molecular formula C14H22NO6- and a molecular weight of 300.33 g/mol. Its IUPAC name is 4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylate.
| Compound Name | 4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 132989321 |
| Molecular Formula | C14H22NO6- |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H23NO6/c1-5-20-11(18)14(10(16)17)6-8-15(9-7-14)12(19)21-13(2,3)4/h5-9H2,1-4H3,(H,16,17)/p-1 |
| InChIKey | XZDZTVFMBGHNPW-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|