C24H40N2O7 — CID 71507823
1-O-tert-butyl 4-O-ethyl 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]piperidine-1,4-dicarboxylate (PubChem CID 71507823) has the molecular formula C24H40N2O7 and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 71507823 |
| Molecular Formula | C24H40N2O7 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]piperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)C2CCN(C(=O)OC(C)(C)C)CC2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H40N2O7/c1-8-31-19(28)24(11-15-26(16-12-24)21(30)33-23(5,6)7)18(27)17-9-13-25(14-10-17)20(29)32-22(2,3)4/h17H,8-16H2,1-7H3 |
| InChIKey | NVAWPOWSKIBZGK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|