C15H25NO5 — CID 82124676
1-O-tert-butyl 4-O-ethyl 4-acetylpiperidine-1,4-dicarboxylate (PubChem CID 82124676) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 4-acetylpiperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl 4-acetylpiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 82124676 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 4-acetylpiperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(C)=O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H25NO5/c1-6-20-12(18)15(11(2)17)7-9-16(10-8-15)13(19)21-14(3,4)5/h6-10H2,1-5H3 |
| InChIKey | GLBCHSPQVZSUNR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|