C16H27NO6 — CID 86719232
tert-butyl 4,4-bis(acetyloxymethyl)piperidine-1-carboxylate (PubChem CID 86719232) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is tert-butyl 4,4-bis(acetyloxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4,4-bis(acetyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86719232 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl 4,4-bis(acetyloxymethyl)piperidine-1-carboxylate |
| SMILES | CC(=O)OCC1(COC(C)=O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H27NO6/c1-12(18)21-10-16(11-22-13(2)19)6-8-17(9-7-16)14(20)23-15(3,4)5/h6-11H2,1-5H3 |
| InChIKey | PTHJOXDJIFJLHM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|