C12H24N2O3 — CID 56698914
tert-butyl 4-(aminomethyl)-4-hydroxyazepane-1-carboxylate (PubChem CID 56698914) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is tert-butyl 4-(aminomethyl)-4-hydroxyazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(aminomethyl)-4-hydroxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 56698914 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | tert-butyl 4-(aminomethyl)-4-hydroxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O)(CN)CC1 |
| InChI | InChI=1S/C12H24N2O3/c1-11(2,3)17-10(15)14-7-4-5-12(16,9-13)6-8-14/h16H,4-9,13H2,1-3H3 |
| InChIKey | IXTYMZYBENRBEC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |