C28H30ClF6NO4 — CID 86633665
1-O-tert-butyl 4-O-ethyl 4-[chloro-bis[4-(trifluoromethyl)phenyl]methyl]piperidine-1,4-dicarboxylate (PubChem CID 86633665) has the molecular formula C28H30ClF6NO4 and a molecular weight of 593.99 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 4-[chloro-bis[4-(trifluoromethyl)phenyl]methyl]piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl 4-[chloro-bis[4-(trifluoromethyl)phenyl]methyl]piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 86633665 |
| Molecular Formula | C28H30ClF6NO4 |
| Molecular Weight | 593.99 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 4-[chloro-bis[4-(trifluoromethyl)phenyl]methyl]piperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(Cl)(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C28H30ClF6NO4/c1-5-39-22(37)25(14-16-36(17-15-25)23(38)40-24(2,3)4)26(29,18-6-10-20(11-7-18)27(30,31)32)19-8-12-21(13-9-19)28(33,34)35/h6-13H,5,14-17H2,1-4H3 |
| InChIKey | RKWFXQZHBBFGKR-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.99 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|