C21H26ClF3N2O5 — CID 146465182
1-O-tert-butyl 3-O-[(2-chloroacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino] 3-methylpyrrolidine-1,3-dicarboxylate (PubChem CID 146465182) has the molecular formula C21H26ClF3N2O5 and a molecular weight of 478.90 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-[(2-chloroacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino] 3-methylpyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-[(2-chloroacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino] 3-methylpyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 146465182 |
| Molecular Formula | C21H26ClF3N2O5 |
| Molecular Weight | 478.90 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 1-O-tert-butyl 3-O-[(2-chloroacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino] 3-methylpyrrolidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(C(=O)ON(Cc2ccc(C(F)(F)F)cc2)C(=O)CCl)C1 |
| InChI | InChI=1S/C21H26ClF3N2O5/c1-19(2,3)31-18(30)26-10-9-20(4,13-26)17(29)32-27(16(28)11-22)12-14-5-7-15(8-6-14)21(23,24)25/h5-8H,9-13H2,1-4H3 |
| InChIKey | FVYKZDUHWXVGCE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.90 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|