C20H26F3NO3 — CID 174333394
tert-butyl (3S,4R)-3-ethenyl-3-hydroxy-4-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine-1-carboxylate (PubChem CID 174333394) has the molecular formula C20H26F3NO3 and a molecular weight of 385.43 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-ethenyl-3-hydroxy-4-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-ethenyl-3-hydroxy-4-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 174333394 |
| Molecular Formula | C20H26F3NO3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | tert-butyl (3S,4R)-3-ethenyl-3-hydroxy-4-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@@]1(O)CN(C(=O)OC(C)(C)C)C[C@H]1CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H26F3NO3/c1-5-19(26)13-24(17(25)27-18(2,3)4)12-16(19)11-8-14-6-9-15(10-7-14)20(21,22)23/h5-7,9-10,16,26H,1,8,11-13H2,2-4H3/t16-,19-/m1/s1 |
| InChIKey | HQGHVQZZXIZQFE-VQIMIIECSA-N |
| XLogP | 4.42 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|